C13H12Cl2N2O4 — CID 78950377
(2S)-4-amino-2-[3-(2,5-dichlorophenyl)prop-2-enoylamino]-4-oxobutanoic acid (PubChem CID 78950377) has the molecular formula C13H12Cl2N2O4 and a molecular weight of 331.16 g/mol. Its IUPAC name is (2S)-4-amino-2-[3-(2,5-dichlorophenyl)prop-2-enoylamino]-4-oxobutanoic acid.
| Compound Name | (2S)-4-amino-2-[3-(2,5-dichlorophenyl)prop-2-enoylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 78950377 |
| Molecular Formula | C13H12Cl2N2O4 |
| Molecular Weight | 331.16 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | (2S)-4-amino-2-[3-(2,5-dichlorophenyl)prop-2-enoylamino]-4-oxobutanoic acid |
| SMILES | NC(=O)C[C@H](NC(=O)C=Cc1cc(Cl)ccc1Cl)C(=O)O |
| InChI | InChI=1S/C13H12Cl2N2O4/c14-8-2-3-9(15)7(5-8)1-4-12(19)17-10(13(20)21)6-11(16)18/h1-5,10H,6H2,(H2,16,18)(H,17,19)(H,20,21)/t10-/m0/s1 |
| InChIKey | NRJGBSGSUGHCNE-JTQLQIEISA-N |
| XLogP | 1.45 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.16 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|