C20H24Cl2FN3O4 — CID 175450916
(2R)-N-(1-amino-5-chloro-1,4-dioxopentan-3-yl)-2-[[(E)-3-(4-chloro-2-fluorophenyl)prop-2-enoyl]amino]-4-methylpentanamide (PubChem CID 175450916) has the molecular formula C20H24Cl2FN3O4 and a molecular weight of 460.33 g/mol. Its IUPAC name is (2R)-N-(1-amino-5-chloro-1,4-dioxopentan-3-yl)-2-[[(E)-3-(4-chloro-2-fluorophenyl)prop-2-enoyl]amino]-4-methylpentanamide.
| Compound Name | (2R)-N-(1-amino-5-chloro-1,4-dioxopentan-3-yl)-2-[[(E)-3-(4-chloro-2-fluorophenyl)prop-2-enoyl]amino]-4-methylpentanamide |
|---|---|
| PubChem CID | 175450916 |
| Molecular Formula | C20H24Cl2FN3O4 |
| Molecular Weight | 460.33 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | (2R)-N-(1-amino-5-chloro-1,4-dioxopentan-3-yl)-2-[[(E)-3-(4-chloro-2-fluorophenyl)prop-2-enoyl]amino]-4-methylpentanamide |
| SMILES | CC(C)C[C@@H](NC(=O)/C=C/c1ccc(Cl)cc1F)C(=O)NC(CC(N)=O)C(=O)CCl |
| InChI | InChI=1S/C20H24Cl2FN3O4/c1-11(2)7-16(20(30)26-15(9-18(24)28)17(27)10-21)25-19(29)6-4-12-3-5-13(22)8-14(12)23/h3-6,8,11,15-16H,7,9-10H2,1-2H3,(H2,24,28)(H,25,29)(H,26,30)/b6-4+/t15?,16-/m1/s1 |
| InChIKey | SVNVFAYSWQLUAF-UKIQGAHASA-N |
| XLogP | 2.19 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.33 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|