C22H25ClFN3O4 — CID 164532131
3-[[(2S)-2-[[(E)-3-(4-chloro-2-fluorophenyl)prop-2-enoyl]amino]-3-cyclopropylpropanoyl]amino]-4-cyclopropyl-2-oxobutanamide (PubChem CID 164532131) has the molecular formula C22H25ClFN3O4 and a molecular weight of 449.91 g/mol. Its IUPAC name is 3-[[(2S)-2-[[(E)-3-(4-chloro-2-fluorophenyl)prop-2-enoyl]amino]-3-cyclopropylpropanoyl]amino]-4-cyclopropyl-2-oxobutanamide.
| Compound Name | 3-[[(2S)-2-[[(E)-3-(4-chloro-2-fluorophenyl)prop-2-enoyl]amino]-3-cyclopropylpropanoyl]amino]-4-cyclopropyl-2-oxobutanamide |
|---|---|
| PubChem CID | 164532131 |
| Molecular Formula | C22H25ClFN3O4 |
| Molecular Weight | 449.91 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | 3-[[(2S)-2-[[(E)-3-(4-chloro-2-fluorophenyl)prop-2-enoyl]amino]-3-cyclopropylpropanoyl]amino]-4-cyclopropyl-2-oxobutanamide |
| SMILES | NC(=O)C(=O)C(CC1CC1)NC(=O)[C@H](CC1CC1)NC(=O)/C=C/c1ccc(Cl)cc1F |
| InChI | InChI=1S/C22H25ClFN3O4/c23-15-7-5-14(16(24)11-15)6-8-19(28)26-18(10-13-3-4-13)22(31)27-17(9-12-1-2-12)20(29)21(25)30/h5-8,11-13,17-18H,1-4,9-10H2,(H2,25,30)(H,26,28)(H,27,31)/b8-6+/t17?,18-/m0/s1 |
| InChIKey | SSTVXMQKKVFHOD-JVYZEVHLSA-N |
| XLogP | 2.12 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.91 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|