C22H29ClFN3O4 — CID 164532124
4-[[2-[[(E)-3-(4-chloro-2-fluorophenyl)prop-2-enoyl]amino]-3-cyclopropylpropanoyl]amino]-N-ethyl-5-hydroxypentanamide (PubChem CID 164532124) has the molecular formula C22H29ClFN3O4 and a molecular weight of 453.94 g/mol. Its IUPAC name is 4-[[2-[[(E)-3-(4-chloro-2-fluorophenyl)prop-2-enoyl]amino]-3-cyclopropylpropanoyl]amino]-N-ethyl-5-hydroxypentanamide.
| Compound Name | 4-[[2-[[(E)-3-(4-chloro-2-fluorophenyl)prop-2-enoyl]amino]-3-cyclopropylpropanoyl]amino]-N-ethyl-5-hydroxypentanamide |
|---|---|
| PubChem CID | 164532124 |
| Molecular Formula | C22H29ClFN3O4 |
| Molecular Weight | 453.94 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 4-[[2-[[(E)-3-(4-chloro-2-fluorophenyl)prop-2-enoyl]amino]-3-cyclopropylpropanoyl]amino]-N-ethyl-5-hydroxypentanamide |
| SMILES | CCNC(=O)CCC(CO)NC(=O)C(CC1CC1)NC(=O)/C=C/c1ccc(Cl)cc1F |
| InChI | InChI=1S/C22H29ClFN3O4/c1-2-25-20(29)10-8-17(13-28)26-22(31)19(11-14-3-4-14)27-21(30)9-6-15-5-7-16(23)12-18(15)24/h5-7,9,12,14,17,19,28H,2-4,8,10-11,13H2,1H3,(H,25,29)(H,26,31)(H,27,30)/b9-6+ |
| InChIKey | QTPGKDWWVQTYDB-RMKNXTFCSA-N |
| XLogP | 2.17 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.94 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|