C23H26ClFN4O4 — CID 174217068
(2S)-2-[[(E)-3-(4-chloro-2-fluorophenyl)prop-2-enoyl]amino]-N-[1-cyano-1-hydroxy-3-(2-oxopyrrolidin-3-yl)propan-2-yl]-3-cyclopropylpropanamide (PubChem CID 174217068) has the molecular formula C23H26ClFN4O4 and a molecular weight of 476.94 g/mol. Its IUPAC name is (2S)-2-[[(E)-3-(4-chloro-2-fluorophenyl)prop-2-enoyl]amino]-N-[1-cyano-1-hydroxy-3-(2-oxopyrrolidin-3-yl)propan-2-yl]-3-cyclopropylpropanamide.
| Compound Name | (2S)-2-[[(E)-3-(4-chloro-2-fluorophenyl)prop-2-enoyl]amino]-N-[1-cyano-1-hydroxy-3-(2-oxopyrrolidin-3-yl)propan-2-yl]-3-cyclopropylpropanamide |
|---|---|
| PubChem CID | 174217068 |
| Molecular Formula | C23H26ClFN4O4 |
| Molecular Weight | 476.94 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | (2S)-2-[[(E)-3-(4-chloro-2-fluorophenyl)prop-2-enoyl]amino]-N-[1-cyano-1-hydroxy-3-(2-oxopyrrolidin-3-yl)propan-2-yl]-3-cyclopropylpropanamide |
| SMILES | N#CC(O)C(CC1CCNC1=O)NC(=O)[C@H](CC1CC1)NC(=O)/C=C/c1ccc(Cl)cc1F |
| InChI | InChI=1S/C23H26ClFN4O4/c24-16-5-3-14(17(25)11-16)4-6-21(31)28-19(9-13-1-2-13)23(33)29-18(20(30)12-26)10-15-7-8-27-22(15)32/h3-6,11,13,15,18-20,30H,1-2,7-10H2,(H,27,32)(H,28,31)(H,29,33)/b6-4+/t15?,18?,19-,20?/m0/s1 |
| InChIKey | GGSPLSNCJSQCJB-OPJRJXFUSA-N |
| XLogP | 1.67 |
| TPSA | 131.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.94 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|