C23H30N4O4 — CID 164532150
5-cyano-4-[[(2S)-3-cyclopropyl-2-[[(E)-3-phenylprop-2-enoyl]amino]propanoyl]amino]-N-ethyl-5-hydroxypentanamide (PubChem CID 164532150) has the molecular formula C23H30N4O4 and a molecular weight of 426.52 g/mol. Its IUPAC name is 5-cyano-4-[[(2S)-3-cyclopropyl-2-[[(E)-3-phenylprop-2-enoyl]amino]propanoyl]amino]-N-ethyl-5-hydroxypentanamide.
| Compound Name | 5-cyano-4-[[(2S)-3-cyclopropyl-2-[[(E)-3-phenylprop-2-enoyl]amino]propanoyl]amino]-N-ethyl-5-hydroxypentanamide |
|---|---|
| PubChem CID | 164532150 |
| Molecular Formula | C23H30N4O4 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | 5-cyano-4-[[(2S)-3-cyclopropyl-2-[[(E)-3-phenylprop-2-enoyl]amino]propanoyl]amino]-N-ethyl-5-hydroxypentanamide |
| SMILES | CCNC(=O)CCC(NC(=O)[C@H](CC1CC1)NC(=O)/C=C/c1ccccc1)C(O)C#N |
| InChI | InChI=1S/C23H30N4O4/c1-2-25-21(29)13-11-18(20(28)15-24)27-23(31)19(14-17-8-9-17)26-22(30)12-10-16-6-4-3-5-7-16/h3-7,10,12,17-20,28H,2,8-9,11,13-14H2,1H3,(H,25,29)(H,26,30)(H,27,31)/b12-10+/t18?,19-,20?/m0/s1 |
| InChIKey | FIMMASHHSRRZAW-AKYHPOCYSA-N |
| XLogP | 1.27 |
| TPSA | 131.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|