C13H13Cl2NO4 — CID 107822045
(2S)-2-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]-4-hydroxybutanoic acid (PubChem CID 107822045) has the molecular formula C13H13Cl2NO4 and a molecular weight of 318.16 g/mol. Its IUPAC name is (2S)-2-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]-4-hydroxybutanoic acid.
| Compound Name | (2S)-2-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107822045 |
| Molecular Formula | C13H13Cl2NO4 |
| Molecular Weight | 318.16 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | (2S)-2-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]-4-hydroxybutanoic acid |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1Cl)N[C@@H](CCO)C(=O)O |
| InChI | InChI=1S/C13H13Cl2NO4/c14-9-3-1-8(10(15)7-9)2-4-12(18)16-11(5-6-17)13(19)20/h1-4,7,11,17H,5-6H2,(H,16,18)(H,19,20)/b4-2+/t11-/m0/s1 |
| InChIKey | AVXFRZXVWAZCFD-FWEMWIAWSA-N |
| XLogP | 1.96 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.16 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|