C11H12Cl2N2O — CID 9163694
(E)-3-(2,4-dichlorophenyl)-N',N'-dimethylprop-2-enehydrazide (PubChem CID 9163694) has the molecular formula C11H12Cl2N2O and a molecular weight of 259.14 g/mol. Its IUPAC name is (E)-3-(2,4-dichlorophenyl)-N',N'-dimethylprop-2-enehydrazide.
| Compound Name | (E)-3-(2,4-dichlorophenyl)-N',N'-dimethylprop-2-enehydrazide |
|---|---|
| PubChem CID | 9163694 |
| Molecular Formula | C11H12Cl2N2O |
| Molecular Weight | 259.14 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | (E)-3-(2,4-dichlorophenyl)-N',N'-dimethylprop-2-enehydrazide |
| SMILES | CN(C)NC(=O)/C=C/c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H12Cl2N2O/c1-15(2)14-11(16)6-4-8-3-5-9(12)7-10(8)13/h3-7H,1-2H3,(H,14,16)/b6-4+ |
| InChIKey | WGDCFNNGASRSJC-GQCTYLIASA-N |
| XLogP | 2.60 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.14 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|