C21H18Cl4N2O2 — CID 6113892
(E)-3-(2,4-dichlorophenyl)-N-[3-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]propyl]prop-2-enamide (PubChem CID 6113892) has the molecular formula C21H18Cl4N2O2 and a molecular weight of 472.20 g/mol. Its IUPAC name is (E)-3-(2,4-dichlorophenyl)-N-[3-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]propyl]prop-2-enamide.
| Compound Name | (E)-3-(2,4-dichlorophenyl)-N-[3-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 6113892 |
| Molecular Formula | C21H18Cl4N2O2 |
| Molecular Weight | 472.20 g/mol |
| Exact Mass | 470.01 |
| IUPAC Name | (E)-3-(2,4-dichlorophenyl)-N-[3-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]propyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1Cl)NCCCNC(=O)/C=C/c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H18Cl4N2O2/c22-16-6-2-14(18(24)12-16)4-8-20(28)26-10-1-11-27-21(29)9-5-15-3-7-17(23)13-19(15)25/h2-9,12-13H,1,10-11H2,(H,26,28)(H,27,29)/b8-4+,9-5+ |
| InChIKey | FUGJNQQSVFLFBE-KBXRYBNXSA-N |
| XLogP | 5.65 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.20 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|