C16H19Cl2NOS — CID 100754959
(E)-N-(2-cyclopentylsulfanylethyl)-3-(2,4-dichlorophenyl)prop-2-enamide (PubChem CID 100754959) has the molecular formula C16H19Cl2NOS and a molecular weight of 344.31 g/mol. Its IUPAC name is (E)-N-(2-cyclopentylsulfanylethyl)-3-(2,4-dichlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-(2-cyclopentylsulfanylethyl)-3-(2,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 100754959 |
| Molecular Formula | C16H19Cl2NOS |
| Molecular Weight | 344.31 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | (E)-N-(2-cyclopentylsulfanylethyl)-3-(2,4-dichlorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1Cl)NCCSC1CCCC1 |
| InChI | InChI=1S/C16H19Cl2NOS/c17-13-7-5-12(15(18)11-13)6-8-16(20)19-9-10-21-14-3-1-2-4-14/h5-8,11,14H,1-4,9-10H2,(H,19,20)/b8-6+ |
| InChIKey | UECACAHHXCAJRT-SOFGYWHQSA-N |
| XLogP | 4.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.31 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|