C18H16Cl3NOS — CID 51604937
(E)-N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]-3-(2,4-dichlorophenyl)prop-2-enamide (PubChem CID 51604937) has the molecular formula C18H16Cl3NOS and a molecular weight of 400.76 g/mol. Its IUPAC name is (E)-N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]-3-(2,4-dichlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]-3-(2,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 51604937 |
| Molecular Formula | C18H16Cl3NOS |
| Molecular Weight | 400.76 g/mol |
| Exact Mass | 399.00 |
| IUPAC Name | (E)-N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]-3-(2,4-dichlorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1Cl)NCCSCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H16Cl3NOS/c19-15-5-1-13(2-6-15)12-24-10-9-22-18(23)8-4-14-3-7-16(20)11-17(14)21/h1-8,11H,9-10,12H2,(H,22,23)/b8-4+ |
| InChIKey | RALCMTMLKMEDLO-XBXARRHUSA-N |
| XLogP | 5.71 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.76 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|