C18H14Cl2F3NO — CID 2541559
(E)-3-(2,4-dichlorophenyl)-N-[2-[4-(trifluoromethyl)phenyl]ethyl]prop-2-enamide (PubChem CID 2541559) has the molecular formula C18H14Cl2F3NO and a molecular weight of 388.22 g/mol. Its IUPAC name is (E)-3-(2,4-dichlorophenyl)-N-[2-[4-(trifluoromethyl)phenyl]ethyl]prop-2-enamide.
| Compound Name | (E)-3-(2,4-dichlorophenyl)-N-[2-[4-(trifluoromethyl)phenyl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 2541559 |
| Molecular Formula | C18H14Cl2F3NO |
| Molecular Weight | 388.22 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | (E)-3-(2,4-dichlorophenyl)-N-[2-[4-(trifluoromethyl)phenyl]ethyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1Cl)NCCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H14Cl2F3NO/c19-15-7-3-13(16(20)11-15)4-8-17(25)24-10-9-12-1-5-14(6-2-12)18(21,22)23/h1-8,11H,9-10H2,(H,24,25)/b8-4+ |
| InChIKey | QHIYVSKLNKQPMP-XBXARRHUSA-N |
| XLogP | 5.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.22 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|