C17H10Cl3F3N2OS — CID 17104886
(E)-N-[[2-chloro-4-(trifluoromethyl)phenyl]carbamothioyl]-3-(2,4-dichlorophenyl)prop-2-enamide (PubChem CID 17104886) has the molecular formula C17H10Cl3F3N2OS and a molecular weight of 453.70 g/mol. Its IUPAC name is (E)-N-[[2-chloro-4-(trifluoromethyl)phenyl]carbamothioyl]-3-(2,4-dichlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[[2-chloro-4-(trifluoromethyl)phenyl]carbamothioyl]-3-(2,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 17104886 |
| Molecular Formula | C17H10Cl3F3N2OS |
| Molecular Weight | 453.70 g/mol |
| Exact Mass | 451.95 |
| IUPAC Name | (E)-N-[[2-chloro-4-(trifluoromethyl)phenyl]carbamothioyl]-3-(2,4-dichlorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1Cl)NC(=S)Nc1ccc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C17H10Cl3F3N2OS/c18-11-4-1-9(12(19)8-11)2-6-15(26)25-16(27)24-14-5-3-10(7-13(14)20)17(21,22)23/h1-8H,(H2,24,25,26,27)/b6-2+ |
| InChIKey | OUYLIDTUPSQVFV-QHHAFSJGSA-N |
| XLogP | 6.19 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.70 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|