C23H13Cl4N3OS2 — CID 3967066
N-[[5-(1,3-benzothiazol-2-yl)-2,4-dichlorophenyl]carbamothioyl]-3-(2,4-dichlorophenyl)prop-2-enamide (PubChem CID 3967066) has the molecular formula C23H13Cl4N3OS2 and a molecular weight of 553.32 g/mol. Its IUPAC name is N-[[5-(1,3-benzothiazol-2-yl)-2,4-dichlorophenyl]carbamothioyl]-3-(2,4-dichlorophenyl)prop-2-enamide.
| Compound Name | N-[[5-(1,3-benzothiazol-2-yl)-2,4-dichlorophenyl]carbamothioyl]-3-(2,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3967066 |
| Molecular Formula | C23H13Cl4N3OS2 |
| Molecular Weight | 553.32 g/mol |
| Exact Mass | 550.93 |
| IUPAC Name | N-[[5-(1,3-benzothiazol-2-yl)-2,4-dichlorophenyl]carbamothioyl]-3-(2,4-dichlorophenyl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(Cl)cc1Cl)NC(=S)Nc1cc(-c2nc3ccccc3s2)c(Cl)cc1Cl |
| InChI | InChI=1S/C23H13Cl4N3OS2/c24-13-7-5-12(15(25)9-13)6-8-21(31)30-23(32)29-19-10-14(16(26)11-17(19)27)22-28-18-3-1-2-4-20(18)33-22/h1-11H,(H2,29,30,31,32) |
| InChIKey | WIAIAEIPFMRINZ-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.32 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|