C27H16Cl3N3O2S2 — CID 17316155
(E)-N-[[2-(1,3-benzothiazol-2-yl)-4,6-dichlorophenyl]carbamothioyl]-3-[5-(4-chlorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 17316155) has the molecular formula C27H16Cl3N3O2S2 and a molecular weight of 584.94 g/mol. Its IUPAC name is (E)-N-[[2-(1,3-benzothiazol-2-yl)-4,6-dichlorophenyl]carbamothioyl]-3-[5-(4-chlorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[[2-(1,3-benzothiazol-2-yl)-4,6-dichlorophenyl]carbamothioyl]-3-[5-(4-chlorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 17316155 |
| Molecular Formula | C27H16Cl3N3O2S2 |
| Molecular Weight | 584.94 g/mol |
| Exact Mass | 582.97 |
| IUPAC Name | (E)-N-[[2-(1,3-benzothiazol-2-yl)-4,6-dichlorophenyl]carbamothioyl]-3-[5-(4-chlorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2ccc(Cl)cc2)o1)NC(=S)Nc1c(Cl)cc(Cl)cc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C27H16Cl3N3O2S2/c28-16-7-5-15(6-8-16)22-11-9-18(35-22)10-12-24(34)32-27(36)33-25-19(13-17(29)14-20(25)30)26-31-21-3-1-2-4-23(21)37-26/h1-14H,(H2,32,33,34,36)/b12-10+ |
| InChIKey | CZTATHDGOKYDNO-ZRDIBKRKSA-N |
| XLogP | 8.71 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.94 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|