C19H11Cl2N3OS3 — CID 2233664
N-[[2-(1,3-benzothiazol-2-yl)-4,6-dichlorophenyl]carbamothioyl]thiophene-2-carboxamide (PubChem CID 2233664) has the molecular formula C19H11Cl2N3OS3 and a molecular weight of 464.42 g/mol. Its IUPAC name is N-[[2-(1,3-benzothiazol-2-yl)-4,6-dichlorophenyl]carbamothioyl]thiophene-2-carboxamide.
| Compound Name | N-[[2-(1,3-benzothiazol-2-yl)-4,6-dichlorophenyl]carbamothioyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 2233664 |
| Molecular Formula | C19H11Cl2N3OS3 |
| Molecular Weight | 464.42 g/mol |
| Exact Mass | 462.94 |
| IUPAC Name | N-[[2-(1,3-benzothiazol-2-yl)-4,6-dichlorophenyl]carbamothioyl]thiophene-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1c(Cl)cc(Cl)cc1-c1nc2ccccc2s1)c1cccs1 |
| InChI | InChI=1S/C19H11Cl2N3OS3/c20-10-8-11(18-22-13-4-1-2-5-14(13)28-18)16(12(21)9-10)23-19(26)24-17(25)15-6-3-7-27-15/h1-9H,(H2,23,24,25,26) |
| InChIKey | CVWQNHMNKPSAJD-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.42 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|