C21H12Br2ClN3OS2 — CID 17316168
N-[[2-(1,3-benzothiazol-2-yl)-4,6-dibromophenyl]carbamothioyl]-4-chlorobenzamide (PubChem CID 17316168) has the molecular formula C21H12Br2ClN3OS2 and a molecular weight of 581.74 g/mol. Its IUPAC name is N-[[2-(1,3-benzothiazol-2-yl)-4,6-dibromophenyl]carbamothioyl]-4-chlorobenzamide.
| Compound Name | N-[[2-(1,3-benzothiazol-2-yl)-4,6-dibromophenyl]carbamothioyl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 17316168 |
| Molecular Formula | C21H12Br2ClN3OS2 |
| Molecular Weight | 581.74 g/mol |
| Exact Mass | 578.85 |
| IUPAC Name | N-[[2-(1,3-benzothiazol-2-yl)-4,6-dibromophenyl]carbamothioyl]-4-chlorobenzamide |
| SMILES | O=C(NC(=S)Nc1c(Br)cc(Br)cc1-c1nc2ccccc2s1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H12Br2ClN3OS2/c22-12-9-14(20-25-16-3-1-2-4-17(16)30-20)18(15(23)10-12)26-21(29)27-19(28)11-5-7-13(24)8-6-11/h1-10H,(H2,26,27,28,29) |
| InChIKey | RDFPWABMGJEBNK-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.74 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|