C22H12Br2Cl2N2OS — CID 17318566
(E)-N-[2-(1,3-benzothiazol-2-yl)-4,6-dibromophenyl]-3-(2,4-dichlorophenyl)prop-2-enamide (PubChem CID 17318566) has the molecular formula C22H12Br2Cl2N2OS and a molecular weight of 583.13 g/mol. Its IUPAC name is (E)-N-[2-(1,3-benzothiazol-2-yl)-4,6-dibromophenyl]-3-(2,4-dichlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-(1,3-benzothiazol-2-yl)-4,6-dibromophenyl]-3-(2,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 17318566 |
| Molecular Formula | C22H12Br2Cl2N2OS |
| Molecular Weight | 583.13 g/mol |
| Exact Mass | 579.84 |
| IUPAC Name | (E)-N-[2-(1,3-benzothiazol-2-yl)-4,6-dibromophenyl]-3-(2,4-dichlorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1Cl)Nc1c(Br)cc(Br)cc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C22H12Br2Cl2N2OS/c23-13-9-15(22-27-18-3-1-2-4-19(18)30-22)21(16(24)10-13)28-20(29)8-6-12-5-7-14(25)11-17(12)26/h1-11H,(H,28,29)/b8-6+ |
| InChIKey | FQKARGPHZGVGFR-SOFGYWHQSA-N |
| XLogP | 8.45 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.13 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|