C23H15Br2ClN2O2S — CID 21170855
(E)-N-[2-(1,3-benzothiazol-2-yl)-4-chlorophenyl]-3-(3,5-dibromo-2-methoxyphenyl)prop-2-enamide (PubChem CID 21170855) has the molecular formula C23H15Br2ClN2O2S and a molecular weight of 578.71 g/mol. Its IUPAC name is (E)-N-[2-(1,3-benzothiazol-2-yl)-4-chlorophenyl]-3-(3,5-dibromo-2-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-(1,3-benzothiazol-2-yl)-4-chlorophenyl]-3-(3,5-dibromo-2-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 21170855 |
| Molecular Formula | C23H15Br2ClN2O2S |
| Molecular Weight | 578.71 g/mol |
| Exact Mass | 575.89 |
| IUPAC Name | (E)-N-[2-(1,3-benzothiazol-2-yl)-4-chlorophenyl]-3-(3,5-dibromo-2-methoxyphenyl)prop-2-enamide |
| SMILES | COc1c(Br)cc(Br)cc1/C=C/C(=O)Nc1ccc(Cl)cc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C23H15Br2ClN2O2S/c1-30-22-13(10-14(24)11-17(22)25)6-9-21(29)27-18-8-7-15(26)12-16(18)23-28-19-4-2-3-5-20(19)31-23/h2-12H,1H3,(H,27,29)/b9-6+ |
| InChIKey | YOGNOHGFEFJYEH-RMKNXTFCSA-N |
| XLogP | 7.80 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.71 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|