C20H16Br2N2O2 — CID 17336281
(E)-3-(3,5-dibromo-2-methoxyphenyl)-N-(2-methylquinolin-5-yl)prop-2-enamide (PubChem CID 17336281) has the molecular formula C20H16Br2N2O2 and a molecular weight of 476.17 g/mol. Its IUPAC name is (E)-3-(3,5-dibromo-2-methoxyphenyl)-N-(2-methylquinolin-5-yl)prop-2-enamide.
| Compound Name | (E)-3-(3,5-dibromo-2-methoxyphenyl)-N-(2-methylquinolin-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 17336281 |
| Molecular Formula | C20H16Br2N2O2 |
| Molecular Weight | 476.17 g/mol |
| Exact Mass | 473.96 |
| IUPAC Name | (E)-3-(3,5-dibromo-2-methoxyphenyl)-N-(2-methylquinolin-5-yl)prop-2-enamide |
| SMILES | COc1c(Br)cc(Br)cc1/C=C/C(=O)Nc1cccc2nc(C)ccc12 |
| InChI | InChI=1S/C20H16Br2N2O2/c1-12-6-8-15-17(23-12)4-3-5-18(15)24-19(25)9-7-13-10-14(21)11-16(22)20(13)26-2/h3-11H,1-2H3,(H,24,25)/b9-7+ |
| InChIKey | JUDMAZWXQFXDBB-VQHVLOKHSA-N |
| XLogP | 5.73 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.17 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|