C14H12Br2N2O2S — CID 17361653
(E)-3-(3,5-dibromo-2-methoxyphenyl)-N-(4-methyl-1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 17361653) has the molecular formula C14H12Br2N2O2S and a molecular weight of 432.14 g/mol. Its IUPAC name is (E)-3-(3,5-dibromo-2-methoxyphenyl)-N-(4-methyl-1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-3-(3,5-dibromo-2-methoxyphenyl)-N-(4-methyl-1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 17361653 |
| Molecular Formula | C14H12Br2N2O2S |
| Molecular Weight | 432.14 g/mol |
| Exact Mass | 429.90 |
| IUPAC Name | (E)-3-(3,5-dibromo-2-methoxyphenyl)-N-(4-methyl-1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | COc1c(Br)cc(Br)cc1/C=C/C(=O)Nc1nc(C)cs1 |
| InChI | InChI=1S/C14H12Br2N2O2S/c1-8-7-21-14(17-8)18-12(19)4-3-9-5-10(15)6-11(16)13(9)20-2/h3-7H,1-2H3,(H,17,18,19)/b4-3+ |
| InChIKey | XPLBOSOBGYCOGS-ONEGZZNKSA-N |
| XLogP | 4.64 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.14 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|