C19H13Br2NO4 — CID 4263885
3-(3,5-dibromo-2-methoxyphenyl)-N-(2-oxochromen-6-yl)prop-2-enamide (PubChem CID 4263885) has the molecular formula C19H13Br2NO4 and a molecular weight of 479.12 g/mol. Its IUPAC name is 3-(3,5-dibromo-2-methoxyphenyl)-N-(2-oxochromen-6-yl)prop-2-enamide.
| Compound Name | 3-(3,5-dibromo-2-methoxyphenyl)-N-(2-oxochromen-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 4263885 |
| Molecular Formula | C19H13Br2NO4 |
| Molecular Weight | 479.12 g/mol |
| Exact Mass | 476.92 |
| IUPAC Name | 3-(3,5-dibromo-2-methoxyphenyl)-N-(2-oxochromen-6-yl)prop-2-enamide |
| SMILES | COc1c(Br)cc(Br)cc1C=CC(=O)Nc1ccc2oc(=O)ccc2c1 |
| InChI | InChI=1S/C19H13Br2NO4/c1-25-19-12(8-13(20)10-15(19)21)2-6-17(23)22-14-4-5-16-11(9-14)3-7-18(24)26-16/h2-10H,1H3,(H,22,23) |
| InChIKey | NRYAVHUDVYFFQD-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.12 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|