C19H14BrNO4 — CID 2032727
(E)-3-(5-bromo-2-methoxyphenyl)-N-(2-oxochromen-6-yl)prop-2-enamide (PubChem CID 2032727) has the molecular formula C19H14BrNO4 and a molecular weight of 400.23 g/mol. Its IUPAC name is (E)-3-(5-bromo-2-methoxyphenyl)-N-(2-oxochromen-6-yl)prop-2-enamide.
| Compound Name | (E)-3-(5-bromo-2-methoxyphenyl)-N-(2-oxochromen-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 2032727 |
| Molecular Formula | C19H14BrNO4 |
| Molecular Weight | 400.23 g/mol |
| Exact Mass | 399.01 |
| IUPAC Name | (E)-3-(5-bromo-2-methoxyphenyl)-N-(2-oxochromen-6-yl)prop-2-enamide |
| SMILES | COc1ccc(Br)cc1/C=C/C(=O)Nc1ccc2oc(=O)ccc2c1 |
| InChI | InChI=1S/C19H14BrNO4/c1-24-16-6-4-14(20)10-12(16)2-8-18(22)21-15-5-7-17-13(11-15)3-9-19(23)25-17/h2-11H,1H3,(H,21,22)/b8-2+ |
| InChIKey | FYNCYHBAMZOFHJ-KRXBUXKQSA-N |
| XLogP | 4.22 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.23 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|