C18H13BrN2O4S — CID 3974750
5-bromo-2-methoxy-N-[(2-oxochromen-6-yl)carbamothioyl]benzamide (PubChem CID 3974750) has the molecular formula C18H13BrN2O4S and a molecular weight of 433.28 g/mol. Its IUPAC name is 5-bromo-2-methoxy-N-[(2-oxochromen-6-yl)carbamothioyl]benzamide.
| Compound Name | 5-bromo-2-methoxy-N-[(2-oxochromen-6-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 3974750 |
| Molecular Formula | C18H13BrN2O4S |
| Molecular Weight | 433.28 g/mol |
| Exact Mass | 431.98 |
| IUPAC Name | 5-bromo-2-methoxy-N-[(2-oxochromen-6-yl)carbamothioyl]benzamide |
| SMILES | COc1ccc(Br)cc1C(=O)NC(=S)Nc1ccc2oc(=O)ccc2c1 |
| InChI | InChI=1S/C18H13BrN2O4S/c1-24-15-5-3-11(19)9-13(15)17(23)21-18(26)20-12-4-6-14-10(8-12)2-7-16(22)25-14/h2-9H,1H3,(H2,20,21,23,26) |
| InChIKey | AUJFAUKFZVPDNA-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.28 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|