C23H18BrN3O4S — CID 5037584
5-bromo-2-methoxy-N-[[3-(5-methoxy-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]benzamide (PubChem CID 5037584) has the molecular formula C23H18BrN3O4S and a molecular weight of 512.39 g/mol. Its IUPAC name is 5-bromo-2-methoxy-N-[[3-(5-methoxy-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]benzamide.
| Compound Name | 5-bromo-2-methoxy-N-[[3-(5-methoxy-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 5037584 |
| Molecular Formula | C23H18BrN3O4S |
| Molecular Weight | 512.39 g/mol |
| Exact Mass | 511.02 |
| IUPAC Name | 5-bromo-2-methoxy-N-[[3-(5-methoxy-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]benzamide |
| SMILES | COc1ccc2oc(-c3cccc(NC(=S)NC(=O)c4cc(Br)ccc4OC)c3)nc2c1 |
| InChI | InChI=1S/C23H18BrN3O4S/c1-29-16-7-9-20-18(12-16)26-22(31-20)13-4-3-5-15(10-13)25-23(32)27-21(28)17-11-14(24)6-8-19(17)30-2/h3-12H,1-2H3,(H2,25,27,28,32) |
| InChIKey | LLHOGIDJQJXUGY-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 85.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.39 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|