C21H23N3O3S — CID 5173006
N-[[3-(5-methoxy-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]hexanamide (PubChem CID 5173006) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is N-[[3-(5-methoxy-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]hexanamide.
| Compound Name | N-[[3-(5-methoxy-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]hexanamide |
|---|---|
| PubChem CID | 5173006 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | N-[[3-(5-methoxy-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]hexanamide |
| SMILES | CCCCCC(=O)NC(=S)Nc1cccc(-c2nc3cc(OC)ccc3o2)c1 |
| InChI | InChI=1S/C21H23N3O3S/c1-3-4-5-9-19(25)24-21(28)22-15-8-6-7-14(12-15)20-23-17-13-16(26-2)10-11-18(17)27-20/h6-8,10-13H,3-5,9H2,1-2H3,(H2,22,24,25,28) |
| InChIKey | SWZWSKFBBFNTND-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|