C18H17N3O3S — CID 1344727
N-[[2-(3-methoxyphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]propanamide (PubChem CID 1344727) has the molecular formula C18H17N3O3S and a molecular weight of 355.42 g/mol. Its IUPAC name is N-[[2-(3-methoxyphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]propanamide.
| Compound Name | N-[[2-(3-methoxyphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]propanamide |
|---|---|
| PubChem CID | 1344727 |
| Molecular Formula | C18H17N3O3S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | N-[[2-(3-methoxyphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]propanamide |
| SMILES | CCC(=O)NC(=S)Nc1ccc2oc(-c3cccc(OC)c3)nc2c1 |
| InChI | InChI=1S/C18H17N3O3S/c1-3-16(22)21-18(25)19-12-7-8-15-14(10-12)20-17(24-15)11-5-4-6-13(9-11)23-2/h4-10H,3H2,1-2H3,(H2,19,21,22,25) |
| InChIKey | IYUFOFYOGUPBGK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|