C22H18N2O4 — CID 17092656
N-[2-(3-methoxyphenyl)-1,3-benzoxazol-5-yl]-2-phenoxyacetamide (PubChem CID 17092656) has the molecular formula C22H18N2O4 and a molecular weight of 374.40 g/mol. Its IUPAC name is N-[2-(3-methoxyphenyl)-1,3-benzoxazol-5-yl]-2-phenoxyacetamide.
| Compound Name | N-[2-(3-methoxyphenyl)-1,3-benzoxazol-5-yl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 17092656 |
| Molecular Formula | C22H18N2O4 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | N-[2-(3-methoxyphenyl)-1,3-benzoxazol-5-yl]-2-phenoxyacetamide |
| SMILES | COc1cccc(-c2nc3cc(NC(=O)COc4ccccc4)ccc3o2)c1 |
| InChI | InChI=1S/C22H18N2O4/c1-26-18-9-5-6-15(12-18)22-24-19-13-16(10-11-20(19)28-22)23-21(25)14-27-17-7-3-2-4-8-17/h2-13H,14H2,1H3,(H,23,25) |
| InChIKey | PGUHCAVEFGNANX-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |