C23H20N2O5 — CID 17128537
N-[2-(3,4-dimethoxyphenyl)-1,3-benzoxazol-5-yl]-2-phenoxyacetamide (PubChem CID 17128537) has the molecular formula C23H20N2O5 and a molecular weight of 404.42 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)-1,3-benzoxazol-5-yl]-2-phenoxyacetamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)-1,3-benzoxazol-5-yl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 17128537 |
| Molecular Formula | C23H20N2O5 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)-1,3-benzoxazol-5-yl]-2-phenoxyacetamide |
| SMILES | COc1ccc(-c2nc3cc(NC(=O)COc4ccccc4)ccc3o2)cc1OC |
| InChI | InChI=1S/C23H20N2O5/c1-27-20-10-8-15(12-21(20)28-2)23-25-18-13-16(9-11-19(18)30-23)24-22(26)14-29-17-6-4-3-5-7-17/h3-13H,14H2,1-2H3,(H,24,26) |
| InChIKey | JYDHFAKYINUESZ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 82.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |