C28H28N2O4 — CID 17092663
2-(4-cyclohexylphenoxy)-N-[2-(3-methoxyphenyl)-1,3-benzoxazol-5-yl]acetamide (PubChem CID 17092663) has the molecular formula C28H28N2O4 and a molecular weight of 456.54 g/mol. Its IUPAC name is 2-(4-cyclohexylphenoxy)-N-[2-(3-methoxyphenyl)-1,3-benzoxazol-5-yl]acetamide.
| Compound Name | 2-(4-cyclohexylphenoxy)-N-[2-(3-methoxyphenyl)-1,3-benzoxazol-5-yl]acetamide |
|---|---|
| PubChem CID | 17092663 |
| Molecular Formula | C28H28N2O4 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | 2-(4-cyclohexylphenoxy)-N-[2-(3-methoxyphenyl)-1,3-benzoxazol-5-yl]acetamide |
| SMILES | COc1cccc(-c2nc3cc(NC(=O)COc4ccc(C5CCCCC5)cc4)ccc3o2)c1 |
| InChI | InChI=1S/C28H28N2O4/c1-32-24-9-5-8-21(16-24)28-30-25-17-22(12-15-26(25)34-28)29-27(31)18-33-23-13-10-20(11-14-23)19-6-3-2-4-7-19/h5,8-17,19H,2-4,6-7,18H2,1H3,(H,29,31) |
| InChIKey | GMMIIFMVUYJINC-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |