C28H29N3O6S — CID 4029230
3,4,5-triethoxy-N-[[3-(5-methoxy-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]benzamide (PubChem CID 4029230) has the molecular formula C28H29N3O6S and a molecular weight of 535.62 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[[3-(5-methoxy-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[[3-(5-methoxy-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4029230 |
| Molecular Formula | C28H29N3O6S |
| Molecular Weight | 535.62 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | 3,4,5-triethoxy-N-[[3-(5-methoxy-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]benzamide |
| SMILES | CCOc1cc(C(=O)NC(=S)Nc2cccc(-c3nc4cc(OC)ccc4o3)c2)cc(OCC)c1OCC |
| InChI | InChI=1S/C28H29N3O6S/c1-5-34-23-14-18(15-24(35-6-2)25(23)36-7-3)26(32)31-28(38)29-19-10-8-9-17(13-19)27-30-21-16-20(33-4)11-12-22(21)37-27/h8-16H,5-7H2,1-4H3,(H2,29,31,32,38) |
| InChIKey | LWPQFFSBEYNTKB-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.62 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|