C26H26N4O5S — CID 3509016
3,4,5-triethoxy-N-[[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]benzamide (PubChem CID 3509016) has the molecular formula C26H26N4O5S and a molecular weight of 506.58 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 3509016 |
| Molecular Formula | C26H26N4O5S |
| Molecular Weight | 506.58 g/mol |
| Exact Mass | 506.16 |
| IUPAC Name | 3,4,5-triethoxy-N-[[3-([1,3]oxazolo[4,5-b]pyridin-2-yl)phenyl]carbamothioyl]benzamide |
| SMILES | CCOc1cc(C(=O)NC(=S)Nc2cccc(-c3nc4ncccc4o3)c2)cc(OCC)c1OCC |
| InChI | InChI=1S/C26H26N4O5S/c1-4-32-20-14-17(15-21(33-5-2)22(20)34-6-3)24(31)30-26(36)28-18-10-7-9-16(13-18)25-29-23-19(35-25)11-8-12-27-23/h7-15H,4-6H2,1-3H3,(H2,28,30,31,36) |
| InChIKey | YOTCMWTUNGKCRZ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 107.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.58 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|