C21H26N2O5S — CID 1048188
3,4,5-triethoxy-N-[(3-methoxyphenyl)carbamothioyl]benzamide (PubChem CID 1048188) has the molecular formula C21H26N2O5S and a molecular weight of 418.52 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[(3-methoxyphenyl)carbamothioyl]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[(3-methoxyphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 1048188 |
| Molecular Formula | C21H26N2O5S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 3,4,5-triethoxy-N-[(3-methoxyphenyl)carbamothioyl]benzamide |
| SMILES | CCOc1cc(C(=O)NC(=S)Nc2cccc(OC)c2)cc(OCC)c1OCC |
| InChI | InChI=1S/C21H26N2O5S/c1-5-26-17-11-14(12-18(27-6-2)19(17)28-7-3)20(24)23-21(29)22-15-9-8-10-16(13-15)25-4/h8-13H,5-7H2,1-4H3,(H2,22,23,24,29) |
| InChIKey | KPGOUKOYRGVKIZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|