C24H33N3O4S — CID 3486164
N-[[4-(diethylamino)phenyl]carbamothioyl]-3,4,5-triethoxybenzamide (PubChem CID 3486164) has the molecular formula C24H33N3O4S and a molecular weight of 459.61 g/mol. Its IUPAC name is N-[[4-(diethylamino)phenyl]carbamothioyl]-3,4,5-triethoxybenzamide.
| Compound Name | N-[[4-(diethylamino)phenyl]carbamothioyl]-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 3486164 |
| Molecular Formula | C24H33N3O4S |
| Molecular Weight | 459.61 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | N-[[4-(diethylamino)phenyl]carbamothioyl]-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)NC(=S)Nc2ccc(N(CC)CC)cc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C24H33N3O4S/c1-6-27(7-2)19-13-11-18(12-14-19)25-24(32)26-23(28)17-15-20(29-8-3)22(31-10-5)21(16-17)30-9-4/h11-16H,6-10H2,1-5H3,(H2,25,26,28,32) |
| InChIKey | DWKGLRBNWPHLFI-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.61 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|