C22H26N2O6S — CID 17109789
N-(2,3-dihydro-1,4-benzodioxin-6-ylcarbamothioyl)-3,4,5-triethoxybenzamide (PubChem CID 17109789) has the molecular formula C22H26N2O6S and a molecular weight of 446.53 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-ylcarbamothioyl)-3,4,5-triethoxybenzamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-ylcarbamothioyl)-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 17109789 |
| Molecular Formula | C22H26N2O6S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-ylcarbamothioyl)-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)NC(=S)Nc2ccc3c(c2)OCCO3)cc(OCC)c1OCC |
| InChI | InChI=1S/C22H26N2O6S/c1-4-26-18-11-14(12-19(27-5-2)20(18)28-6-3)21(25)24-22(31)23-15-7-8-16-17(13-15)30-10-9-29-16/h7-8,11-13H,4-6,9-10H2,1-3H3,(H2,23,24,25,31) |
| InChIKey | YSTZUSAWFHNRMS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 87.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|