C23H26N4O6S — CID 3942706
N-[(6-acetamido-1,3-benzoxazol-2-yl)carbamothioyl]-3,4,5-triethoxybenzamide (PubChem CID 3942706) has the molecular formula C23H26N4O6S and a molecular weight of 486.55 g/mol. Its IUPAC name is N-[(6-acetamido-1,3-benzoxazol-2-yl)carbamothioyl]-3,4,5-triethoxybenzamide.
| Compound Name | N-[(6-acetamido-1,3-benzoxazol-2-yl)carbamothioyl]-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 3942706 |
| Molecular Formula | C23H26N4O6S |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | N-[(6-acetamido-1,3-benzoxazol-2-yl)carbamothioyl]-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)NC(=S)Nc2nc3ccc(NC(C)=O)cc3o2)cc(OCC)c1OCC |
| InChI | InChI=1S/C23H26N4O6S/c1-5-30-18-10-14(11-19(31-6-2)20(18)32-7-3)21(29)26-23(34)27-22-25-16-9-8-15(24-13(4)28)12-17(16)33-22/h8-12H,5-7H2,1-4H3,(H,24,28)(H2,25,26,27,29,34) |
| InChIKey | PXVJDKOFOGRDCX-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 123.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|