C19H18N4O5S — CID 3897977
N-[(6-acetamido-1,3-benzoxazol-2-yl)carbamothioyl]-3,5-dimethoxybenzamide (PubChem CID 3897977) has the molecular formula C19H18N4O5S and a molecular weight of 414.44 g/mol. Its IUPAC name is N-[(6-acetamido-1,3-benzoxazol-2-yl)carbamothioyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[(6-acetamido-1,3-benzoxazol-2-yl)carbamothioyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 3897977 |
| Molecular Formula | C19H18N4O5S |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | N-[(6-acetamido-1,3-benzoxazol-2-yl)carbamothioyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)NC(=S)Nc2nc3ccc(NC(C)=O)cc3o2)c1 |
| InChI | InChI=1S/C19H18N4O5S/c1-10(24)20-12-4-5-15-16(8-12)28-18(21-15)23-19(29)22-17(25)11-6-13(26-2)9-14(7-11)27-3/h4-9H,1-3H3,(H,20,24)(H2,21,22,23,25,29) |
| InChIKey | KVUDCUCQRSWZLV-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 114.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|