C17H13ClN4O3S — CID 3904553
N-[(6-acetamido-1,3-benzoxazol-2-yl)carbamothioyl]-2-chlorobenzamide (PubChem CID 3904553) has the molecular formula C17H13ClN4O3S and a molecular weight of 388.84 g/mol. Its IUPAC name is N-[(6-acetamido-1,3-benzoxazol-2-yl)carbamothioyl]-2-chlorobenzamide.
| Compound Name | N-[(6-acetamido-1,3-benzoxazol-2-yl)carbamothioyl]-2-chlorobenzamide |
|---|---|
| PubChem CID | 3904553 |
| Molecular Formula | C17H13ClN4O3S |
| Molecular Weight | 388.84 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | N-[(6-acetamido-1,3-benzoxazol-2-yl)carbamothioyl]-2-chlorobenzamide |
| SMILES | CC(=O)Nc1ccc2nc(NC(=S)NC(=O)c3ccccc3Cl)oc2c1 |
| InChI | InChI=1S/C17H13ClN4O3S/c1-9(23)19-10-6-7-13-14(8-10)25-16(20-13)22-17(26)21-15(24)11-4-2-3-5-12(11)18/h2-8H,1H3,(H,19,23)(H2,20,21,22,24,26) |
| InChIKey | GWIHABIKVFTEKN-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.84 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|