C21H16N4O3S — CID 3983187
N-[(6-acetamido-1,3-benzoxazol-2-yl)carbamothioyl]naphthalene-1-carboxamide (PubChem CID 3983187) has the molecular formula C21H16N4O3S and a molecular weight of 404.45 g/mol. Its IUPAC name is N-[(6-acetamido-1,3-benzoxazol-2-yl)carbamothioyl]naphthalene-1-carboxamide.
| Compound Name | N-[(6-acetamido-1,3-benzoxazol-2-yl)carbamothioyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 3983187 |
| Molecular Formula | C21H16N4O3S |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | N-[(6-acetamido-1,3-benzoxazol-2-yl)carbamothioyl]naphthalene-1-carboxamide |
| SMILES | CC(=O)Nc1ccc2nc(NC(=S)NC(=O)c3cccc4ccccc34)oc2c1 |
| InChI | InChI=1S/C21H16N4O3S/c1-12(26)22-14-9-10-17-18(11-14)28-20(23-17)25-21(29)24-19(27)16-8-4-6-13-5-2-3-7-15(13)16/h2-11H,1H3,(H,22,26)(H2,23,24,25,27,29) |
| InChIKey | KIQWEQRQYDTFEA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|