C18H13BrN2OS — CID 4197624
N-[(3-bromophenyl)carbamothioyl]naphthalene-1-carboxamide (PubChem CID 4197624) has the molecular formula C18H13BrN2OS and a molecular weight of 385.29 g/mol. Its IUPAC name is N-[(3-bromophenyl)carbamothioyl]naphthalene-1-carboxamide.
| Compound Name | N-[(3-bromophenyl)carbamothioyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 4197624 |
| Molecular Formula | C18H13BrN2OS |
| Molecular Weight | 385.29 g/mol |
| Exact Mass | 383.99 |
| IUPAC Name | N-[(3-bromophenyl)carbamothioyl]naphthalene-1-carboxamide |
| SMILES | O=C(NC(=S)Nc1cccc(Br)c1)c1cccc2ccccc12 |
| InChI | InChI=1S/C18H13BrN2OS/c19-13-7-4-8-14(11-13)20-18(23)21-17(22)16-10-3-6-12-5-1-2-9-15(12)16/h1-11H,(H2,20,21,22,23) |
| InChIKey | RDUQJXKEOGTRAT-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.29 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|