C12H9BrN2OS2 — CID 17099615
N-[(3-bromophenyl)carbamothioyl]thiophene-2-carboxamide (PubChem CID 17099615) has the molecular formula C12H9BrN2OS2 and a molecular weight of 341.26 g/mol. Its IUPAC name is N-[(3-bromophenyl)carbamothioyl]thiophene-2-carboxamide.
| Compound Name | N-[(3-bromophenyl)carbamothioyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 17099615 |
| Molecular Formula | C12H9BrN2OS2 |
| Molecular Weight | 341.26 g/mol |
| Exact Mass | 339.93 |
| IUPAC Name | N-[(3-bromophenyl)carbamothioyl]thiophene-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1cccc(Br)c1)c1cccs1 |
| InChI | InChI=1S/C12H9BrN2OS2/c13-8-3-1-4-9(7-8)14-12(17)15-11(16)10-5-2-6-18-10/h1-7H,(H2,14,15,16,17) |
| InChIKey | HTMVDKFHWAWMNX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.26 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|