C12H10BrN3OS2 — CID 18708934
1-(4-bromophenyl)-3-(thiophene-2-carbonylamino)thiourea (PubChem CID 18708934) has the molecular formula C12H10BrN3OS2 and a molecular weight of 356.27 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-(thiophene-2-carbonylamino)thiourea.
| Compound Name | 1-(4-bromophenyl)-3-(thiophene-2-carbonylamino)thiourea |
|---|---|
| PubChem CID | 18708934 |
| Molecular Formula | C12H10BrN3OS2 |
| Molecular Weight | 356.27 g/mol |
| Exact Mass | 354.94 |
| IUPAC Name | 1-(4-bromophenyl)-3-(thiophene-2-carbonylamino)thiourea |
| SMILES | O=C(NNC(=S)Nc1ccc(Br)cc1)c1cccs1 |
| InChI | InChI=1S/C12H10BrN3OS2/c13-8-3-5-9(6-4-8)14-12(18)16-15-11(17)10-2-1-7-19-10/h1-7H,(H,15,17)(H2,14,16,18) |
| InChIKey | YTXXKRRTSIIEKA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.27 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|