C12H10N2OS2 — CID 817333
N-(phenylcarbamothioyl)thiophene-2-carboxamide (PubChem CID 817333) has the molecular formula C12H10N2OS2 and a molecular weight of 262.36 g/mol. Its IUPAC name is N-(phenylcarbamothioyl)thiophene-2-carboxamide.
| Compound Name | N-(phenylcarbamothioyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 817333 |
| Molecular Formula | C12H10N2OS2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | N-(phenylcarbamothioyl)thiophene-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccccc1)c1cccs1 |
| InChI | InChI=1S/C12H10N2OS2/c15-11(10-7-4-8-17-10)14-12(16)13-9-5-2-1-3-6-9/h1-8H,(H2,13,14,15,16) |
| InChIKey | OBQJVYAELQGLJJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|