C17H19N3O2S2 — CID 28639659
N-[[3-(tert-butylcarbamoyl)phenyl]carbamothioyl]thiophene-2-carboxamide (PubChem CID 28639659) has the molecular formula C17H19N3O2S2 and a molecular weight of 361.49 g/mol. Its IUPAC name is N-[[3-(tert-butylcarbamoyl)phenyl]carbamothioyl]thiophene-2-carboxamide.
| Compound Name | N-[[3-(tert-butylcarbamoyl)phenyl]carbamothioyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 28639659 |
| Molecular Formula | C17H19N3O2S2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | N-[[3-(tert-butylcarbamoyl)phenyl]carbamothioyl]thiophene-2-carboxamide |
| SMILES | CC(C)(C)NC(=O)c1cccc(NC(=S)NC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C17H19N3O2S2/c1-17(2,3)20-14(21)11-6-4-7-12(10-11)18-16(23)19-15(22)13-8-5-9-24-13/h4-10H,1-3H3,(H,20,21)(H2,18,19,22,23) |
| InChIKey | ZSGILGUXXYWMCQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|