C17H25N3O2S — CID 28639697
N-tert-butyl-3-(2,2-dimethylpropanoylcarbamothioylamino)benzamide (PubChem CID 28639697) has the molecular formula C17H25N3O2S and a molecular weight of 335.47 g/mol. Its IUPAC name is N-tert-butyl-3-(2,2-dimethylpropanoylcarbamothioylamino)benzamide.
| Compound Name | N-tert-butyl-3-(2,2-dimethylpropanoylcarbamothioylamino)benzamide |
|---|---|
| PubChem CID | 28639697 |
| Molecular Formula | C17H25N3O2S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | N-tert-butyl-3-(2,2-dimethylpropanoylcarbamothioylamino)benzamide |
| SMILES | CC(C)(C)NC(=O)c1cccc(NC(=S)NC(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C17H25N3O2S/c1-16(2,3)14(22)19-15(23)18-12-9-7-8-11(10-12)13(21)20-17(4,5)6/h7-10H,1-6H3,(H,20,21)(H2,18,19,22,23) |
| InChIKey | XOQLIDZLNBZLEP-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|