C18H25N3O3S — CID 42427599
3-(2,2-dimethylpropanoylcarbamothioylamino)-N-[[(2S)-oxolan-2-yl]methyl]benzamide (PubChem CID 42427599) has the molecular formula C18H25N3O3S and a molecular weight of 363.48 g/mol. Its IUPAC name is 3-(2,2-dimethylpropanoylcarbamothioylamino)-N-[[(2S)-oxolan-2-yl]methyl]benzamide.
| Compound Name | 3-(2,2-dimethylpropanoylcarbamothioylamino)-N-[[(2S)-oxolan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 42427599 |
| Molecular Formula | C18H25N3O3S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 3-(2,2-dimethylpropanoylcarbamothioylamino)-N-[[(2S)-oxolan-2-yl]methyl]benzamide |
| SMILES | CC(C)(C)C(=O)NC(=S)Nc1cccc(C(=O)NC[C@@H]2CCCO2)c1 |
| InChI | InChI=1S/C18H25N3O3S/c1-18(2,3)16(23)21-17(25)20-13-7-4-6-12(10-13)15(22)19-11-14-8-5-9-24-14/h4,6-7,10,14H,5,8-9,11H2,1-3H3,(H,19,22)(H2,20,21,23,25)/t14-/m0/s1 |
| InChIKey | QKHVZPLOTVTING-AWEZNQCLSA-N |
| XLogP | 2.45 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|