C22H22ClN3O3S — CID 17202638
3-[[(E)-3-(2-chlorophenyl)prop-2-enoyl]carbamothioylamino]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 17202638) has the molecular formula C22H22ClN3O3S and a molecular weight of 443.96 g/mol. Its IUPAC name is 3-[[(E)-3-(2-chlorophenyl)prop-2-enoyl]carbamothioylamino]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 3-[[(E)-3-(2-chlorophenyl)prop-2-enoyl]carbamothioylamino]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 17202638 |
| Molecular Formula | C22H22ClN3O3S |
| Molecular Weight | 443.96 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | 3-[[(E)-3-(2-chlorophenyl)prop-2-enoyl]carbamothioylamino]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | O=C(/C=C/c1ccccc1Cl)NC(=S)Nc1cccc(C(=O)NCC2CCCO2)c1 |
| InChI | InChI=1S/C22H22ClN3O3S/c23-19-9-2-1-5-15(19)10-11-20(27)26-22(30)25-17-7-3-6-16(13-17)21(28)24-14-18-8-4-12-29-18/h1-3,5-7,9-11,13,18H,4,8,12,14H2,(H,24,28)(H2,25,26,27,30)/b11-10+ |
| InChIKey | CFYYKNJVYWSBLS-ZHACJKMWSA-N |
| XLogP | 3.78 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.96 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|