C24H27N3O4S — CID 17227597
3-[[(E)-3-(4-ethoxyphenyl)prop-2-enoyl]carbamothioylamino]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 17227597) has the molecular formula C24H27N3O4S and a molecular weight of 453.56 g/mol. Its IUPAC name is 3-[[(E)-3-(4-ethoxyphenyl)prop-2-enoyl]carbamothioylamino]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 3-[[(E)-3-(4-ethoxyphenyl)prop-2-enoyl]carbamothioylamino]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 17227597 |
| Molecular Formula | C24H27N3O4S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | 3-[[(E)-3-(4-ethoxyphenyl)prop-2-enoyl]carbamothioylamino]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | CCOc1ccc(/C=C/C(=O)NC(=S)Nc2cccc(C(=O)NCC3CCCO3)c2)cc1 |
| InChI | InChI=1S/C24H27N3O4S/c1-2-30-20-11-8-17(9-12-20)10-13-22(28)27-24(32)26-19-6-3-5-18(15-19)23(29)25-16-21-7-4-14-31-21/h3,5-6,8-13,15,21H,2,4,7,14,16H2,1H3,(H,25,29)(H2,26,27,28,32)/b13-10+ |
| InChIKey | QKSPWAWGXDJUKR-JLHYYAGUSA-N |
| XLogP | 3.52 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|