C24H29N3O5S — CID 17202708
2-(2-ethoxyethoxy)-N-[[3-(oxolan-2-ylmethylcarbamoyl)phenyl]carbamothioyl]benzamide (PubChem CID 17202708) has the molecular formula C24H29N3O5S and a molecular weight of 471.58 g/mol. Its IUPAC name is 2-(2-ethoxyethoxy)-N-[[3-(oxolan-2-ylmethylcarbamoyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 2-(2-ethoxyethoxy)-N-[[3-(oxolan-2-ylmethylcarbamoyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17202708 |
| Molecular Formula | C24H29N3O5S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 2-(2-ethoxyethoxy)-N-[[3-(oxolan-2-ylmethylcarbamoyl)phenyl]carbamothioyl]benzamide |
| SMILES | CCOCCOc1ccccc1C(=O)NC(=S)Nc1cccc(C(=O)NCC2CCCO2)c1 |
| InChI | InChI=1S/C24H29N3O5S/c1-2-30-13-14-32-21-11-4-3-10-20(21)23(29)27-24(33)26-18-8-5-7-17(15-18)22(28)25-16-19-9-6-12-31-19/h3-5,7-8,10-11,15,19H,2,6,9,12-14,16H2,1H3,(H,25,28)(H2,26,27,29,33) |
| InChIKey | DPAIUGNDYRPWBP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|