C23H28N2O5S — CID 17142058
3-(2-ethoxyethoxy)-N-[[3-(oxolan-2-ylmethoxy)phenyl]carbamothioyl]benzamide (PubChem CID 17142058) has the molecular formula C23H28N2O5S and a molecular weight of 444.55 g/mol. Its IUPAC name is 3-(2-ethoxyethoxy)-N-[[3-(oxolan-2-ylmethoxy)phenyl]carbamothioyl]benzamide.
| Compound Name | 3-(2-ethoxyethoxy)-N-[[3-(oxolan-2-ylmethoxy)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17142058 |
| Molecular Formula | C23H28N2O5S |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 3-(2-ethoxyethoxy)-N-[[3-(oxolan-2-ylmethoxy)phenyl]carbamothioyl]benzamide |
| SMILES | CCOCCOc1cccc(C(=O)NC(=S)Nc2cccc(OCC3CCCO3)c2)c1 |
| InChI | InChI=1S/C23H28N2O5S/c1-2-27-12-13-29-19-8-3-6-17(14-19)22(26)25-23(31)24-18-7-4-9-20(15-18)30-16-21-10-5-11-28-21/h3-4,6-9,14-15,21H,2,5,10-13,16H2,1H3,(H2,24,25,26,31) |
| InChIKey | PTGJZHCTERXJKP-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|